C22H22Cl2N4O2S — CID 135693057
(2E)-N-(2,5-dichlorophenyl)-4-oxo-2-[(Z)-1-phenylpentylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide (PubChem CID 135693057) has the molecular formula C22H22Cl2N4O2S and a molecular weight of 477.42 g/mol. Its IUPAC name is (2E)-N-(2,5-dichlorophenyl)-4-oxo-2-[(Z)-1-phenylpentylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide.
| Compound Name | (2E)-N-(2,5-dichlorophenyl)-4-oxo-2-[(Z)-1-phenylpentylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135693057 |
| Molecular Formula | C22H22Cl2N4O2S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | (2E)-N-(2,5-dichlorophenyl)-4-oxo-2-[(Z)-1-phenylpentylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
| SMILES | CCCC/C(=N/N=C1\NC(=O)CC(C(=O)Nc2cc(Cl)ccc2Cl)S1)c1ccccc1 |
| InChI | InChI=1S/C22H22Cl2N4O2S/c1-2-3-9-17(14-7-5-4-6-8-14)27-28-22-26-20(29)13-19(31-22)21(30)25-18-12-15(23)10-11-16(18)24/h4-8,10-12,19H,2-3,9,13H2,1H3,(H,25,30)(H,26,28,29)/b27-17- |
| InChIKey | IHNUYFMILWSBNL-PKAZHMFMSA-N |
| XLogP | 5.50 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|