C22H23BrN4O2S — CID 135625743
(2E)-N-(4-bromophenyl)-4-oxo-2-(1-phenylpentylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide (PubChem CID 135625743) has the molecular formula C22H23BrN4O2S and a molecular weight of 487.42 g/mol. Its IUPAC name is (2E)-N-(4-bromophenyl)-4-oxo-2-(1-phenylpentylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide.
| Compound Name | (2E)-N-(4-bromophenyl)-4-oxo-2-(1-phenylpentylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135625743 |
| Molecular Formula | C22H23BrN4O2S |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | (2E)-N-(4-bromophenyl)-4-oxo-2-(1-phenylpentylidenehydrazinylidene)-1,3-thiazinane-6-carboxamide |
| SMILES | CCCCC(=N/N=C1\NC(=O)CC(C(=O)Nc2ccc(Br)cc2)S1)c1ccccc1 |
| InChI | InChI=1S/C22H23BrN4O2S/c1-2-3-9-18(15-7-5-4-6-8-15)26-27-22-25-20(28)14-19(30-22)21(29)24-17-12-10-16(23)11-13-17/h4-8,10-13,19H,2-3,9,14H2,1H3,(H,24,29)(H,25,27,28) |
| InChIKey | FDNCQWGWJCYQHP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|