C22H23N5O4S — CID 135693056
(2E)-N-(3-nitrophenyl)-4-oxo-2-[(Z)-1-phenylpentylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide (PubChem CID 135693056) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is (2E)-N-(3-nitrophenyl)-4-oxo-2-[(Z)-1-phenylpentylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide.
| Compound Name | (2E)-N-(3-nitrophenyl)-4-oxo-2-[(Z)-1-phenylpentylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135693056 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (2E)-N-(3-nitrophenyl)-4-oxo-2-[(Z)-1-phenylpentylidenehydrazinylidene]-1,3-thiazinane-6-carboxamide |
| SMILES | CCCC/C(=N/N=C1\NC(=O)CC(C(=O)Nc2cccc([N+](=O)[O-])c2)S1)c1ccccc1 |
| InChI | InChI=1S/C22H23N5O4S/c1-2-3-12-18(15-8-5-4-6-9-15)25-26-22-24-20(28)14-19(32-22)21(29)23-16-10-7-11-17(13-16)27(30)31/h4-11,13,19H,2-3,12,14H2,1H3,(H,23,29)(H,24,26,28)/b25-18- |
| InChIKey | HRPUJJSWLDWOMQ-BWAHOGKJSA-N |
| XLogP | 4.11 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|