C20H20N4O4S — CID 135399274
2-[(2-methoxybenzoyl)hydrazinylidene]-N-(3-methylphenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 135399274) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[(2-methoxybenzoyl)hydrazinylidene]-N-(3-methylphenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[(2-methoxybenzoyl)hydrazinylidene]-N-(3-methylphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135399274 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-[(2-methoxybenzoyl)hydrazinylidene]-N-(3-methylphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccccc1C(=O)NN=C1NC(=O)CC(C(=O)Nc2cccc(C)c2)S1 |
| InChI | InChI=1S/C20H20N4O4S/c1-12-6-5-7-13(10-12)21-19(27)16-11-17(25)22-20(29-16)24-23-18(26)14-8-3-4-9-15(14)28-2/h3-10,16H,11H2,1-2H3,(H,21,27)(H,23,26)(H,22,24,25) |
| InChIKey | RMYNCQMLFJEDQP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|