C25H22N4O5S — CID 135399264
2-[(2-methoxybenzoyl)hydrazinylidene]-4-oxo-N-(4-phenoxyphenyl)-1,3-thiazinane-6-carboxamide (PubChem CID 135399264) has the molecular formula C25H22N4O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-[(2-methoxybenzoyl)hydrazinylidene]-4-oxo-N-(4-phenoxyphenyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[(2-methoxybenzoyl)hydrazinylidene]-4-oxo-N-(4-phenoxyphenyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135399264 |
| Molecular Formula | C25H22N4O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-[(2-methoxybenzoyl)hydrazinylidene]-4-oxo-N-(4-phenoxyphenyl)-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccccc1C(=O)NN=C1NC(=O)CC(C(=O)Nc2ccc(Oc3ccccc3)cc2)S1 |
| InChI | InChI=1S/C25H22N4O5S/c1-33-20-10-6-5-9-19(20)23(31)28-29-25-27-22(30)15-21(35-25)24(32)26-16-11-13-18(14-12-16)34-17-7-3-2-4-8-17/h2-14,21H,15H2,1H3,(H,26,32)(H,28,31)(H,27,29,30) |
| InChIKey | RJSPNOSZFOZPNW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|