C18H15ClN4O3S — CID 135745670
(2E,6S)-2-[(2-chlorobenzoyl)hydrazinylidene]-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide (PubChem CID 135745670) has the molecular formula C18H15ClN4O3S and a molecular weight of 402.86 g/mol. Its IUPAC name is (2E,6S)-2-[(2-chlorobenzoyl)hydrazinylidene]-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide.
| Compound Name | (2E,6S)-2-[(2-chlorobenzoyl)hydrazinylidene]-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135745670 |
| Molecular Formula | C18H15ClN4O3S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (2E,6S)-2-[(2-chlorobenzoyl)hydrazinylidene]-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)Nc2ccccc2)S/C(=N/NC(=O)c2ccccc2Cl)N1 |
| InChI | InChI=1S/C18H15ClN4O3S/c19-13-9-5-4-8-12(13)16(25)22-23-18-21-15(24)10-14(27-18)17(26)20-11-6-2-1-3-7-11/h1-9,14H,10H2,(H,20,26)(H,22,25)(H,21,23,24)/t14-/m0/s1 |
| InChIKey | DTYVVPGOGKBTKJ-AWEZNQCLSA-N |
| XLogP | 2.60 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|