C22H22N6O3 — CID 135885788
4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (PubChem CID 135885788) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine.
| Compound Name | 4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
|---|---|
| PubChem CID | 135885788 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| SMILES | COc1cc(C2N=C(N)Nc3nc4ccccc4n32)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C22H22N6O3/c1-12-15(13(2)31-27-12)11-30-18-9-8-14(10-19(18)29-3)20-25-21(23)26-22-24-16-6-4-5-7-17(16)28(20)22/h4-10,20H,11H2,1-3H3,(H3,23,24,25,26) |
| InChIKey | BEFFKADYEVKAFE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 112.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |