C20H18N6OS — CID 135909156
(4S)-4-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (PubChem CID 135909156) has the molecular formula C20H18N6OS and a molecular weight of 390.47 g/mol. Its IUPAC name is (4S)-4-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine.
| Compound Name | (4S)-4-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
|---|---|
| PubChem CID | 135909156 |
| Molecular Formula | C20H18N6OS |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (4S)-4-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| SMILES | Cc1nc(COc2ccc([C@H]3N=C(N)Nc4nc5ccccc5n43)cc2)cs1 |
| InChI | InChI=1S/C20H18N6OS/c1-12-22-14(11-28-12)10-27-15-8-6-13(7-9-15)18-24-19(21)25-20-23-16-4-2-3-5-17(16)26(18)20/h2-9,11,18H,10H2,1H3,(H3,21,23,24,25)/t18-/m0/s1 |
| InChIKey | PJBVMZRFUTVYTR-SFHVURJKSA-N |
| XLogP | 3.67 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |