C21H17ClN4O3 — CID 135886268
(5R,8R)-8-(4-chlorophenyl)-5-(4-hydroxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one (PubChem CID 135886268) has the molecular formula C21H17ClN4O3 and a molecular weight of 408.85 g/mol. Its IUPAC name is (5R,8R)-8-(4-chlorophenyl)-5-(4-hydroxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one.
| Compound Name | (5R,8R)-8-(4-chlorophenyl)-5-(4-hydroxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 135886268 |
| Molecular Formula | C21H17ClN4O3 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (5R,8R)-8-(4-chlorophenyl)-5-(4-hydroxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
| SMILES | O=C1C[C@H](c2ccc(Cl)cc2)CC2=C1[C@@H](c1ccc(O)cc1)Nc1nonc1N2 |
| InChI | InChI=1S/C21H17ClN4O3/c22-14-5-1-11(2-6-14)13-9-16-18(17(28)10-13)19(12-3-7-15(27)8-4-12)24-21-20(23-16)25-29-26-21/h1-8,13,19,27H,9-10H2,(H,23,25)(H,24,26)/t13-,19-/m1/s1 |
| InChIKey | ABXOXHZYVKDATD-BFUOFWGJSA-N |
| XLogP | 4.41 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |