C19H16N4O3S — CID 135929768
(5R,8S)-5-(3-hydroxyphenyl)-8-thiophen-2-yl-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one (PubChem CID 135929768) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is (5R,8S)-5-(3-hydroxyphenyl)-8-thiophen-2-yl-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one.
| Compound Name | (5R,8S)-5-(3-hydroxyphenyl)-8-thiophen-2-yl-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 135929768 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (5R,8S)-5-(3-hydroxyphenyl)-8-thiophen-2-yl-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
| SMILES | O=C1C[C@@H](c2cccs2)CC2=C1[C@@H](c1cccc(O)c1)Nc1nonc1N2 |
| InChI | InChI=1S/C19H16N4O3S/c24-12-4-1-3-10(7-12)17-16-13(20-18-19(21-17)23-26-22-18)8-11(9-14(16)25)15-5-2-6-27-15/h1-7,11,17,24H,8-9H2,(H,20,22)(H,21,23)/t11-,17+/m0/s1 |
| InChIKey | BETPWRJQEJECOB-APPDUMDISA-N |
| XLogP | 3.82 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |