C22H22N4O5S — CID 135929789
(5R,8R)-8-thiophen-2-yl-5-(2,3,4-trimethoxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one (PubChem CID 135929789) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is (5R,8R)-8-thiophen-2-yl-5-(2,3,4-trimethoxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one.
| Compound Name | (5R,8R)-8-thiophen-2-yl-5-(2,3,4-trimethoxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 135929789 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | (5R,8R)-8-thiophen-2-yl-5-(2,3,4-trimethoxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
| SMILES | COc1ccc([C@H]2Nc3nonc3NC3=C2C(=O)C[C@H](c2cccs2)C3)c(OC)c1OC |
| InChI | InChI=1S/C22H22N4O5S/c1-28-15-7-6-12(19(29-2)20(15)30-3)18-17-13(23-21-22(24-18)26-31-25-21)9-11(10-14(17)27)16-5-4-8-32-16/h4-8,11,18H,9-10H2,1-3H3,(H,23,25)(H,24,26)/t11-,18-/m1/s1 |
| InChIKey | ROYAQOKIEQYAGS-ADLMAVQZSA-N |
| XLogP | 4.14 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |