C17H13ClN6O — CID 135886871
2-[1-[5-(4-chlorophenyl)tetrazol-2-yl]ethyl]-3H-quinazolin-4-one (PubChem CID 135886871) has the molecular formula C17H13ClN6O and a molecular weight of 352.79 g/mol. Its IUPAC name is 2-[1-[5-(4-chlorophenyl)tetrazol-2-yl]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[1-[5-(4-chlorophenyl)tetrazol-2-yl]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135886871 |
| Molecular Formula | C17H13ClN6O |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-[1-[5-(4-chlorophenyl)tetrazol-2-yl]ethyl]-3H-quinazolin-4-one |
| SMILES | CC(c1nc2ccccc2c(=O)[nH]1)n1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H13ClN6O/c1-10(15-19-14-5-3-2-4-13(14)17(25)20-15)24-22-16(21-23-24)11-6-8-12(18)9-7-11/h2-10H,1H3,(H,19,20,25) |
| InChIKey | HRCOSWRPZATPBJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |