C17H16ClF2N3O2S2 — CID 135887322
1-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea (PubChem CID 135887322) has the molecular formula C17H16ClF2N3O2S2 and a molecular weight of 431.92 g/mol. Its IUPAC name is 1-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea.
| Compound Name | 1-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
|---|---|
| PubChem CID | 135887322 |
| Molecular Formula | C17H16ClF2N3O2S2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 1-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
| SMILES | CCOc1cc(/C=N\NC(=S)Nc2ccc(SC(F)F)cc2)cc(Cl)c1O |
| InChI | InChI=1S/C17H16ClF2N3O2S2/c1-2-25-14-8-10(7-13(18)15(14)24)9-21-23-17(26)22-11-3-5-12(6-4-11)27-16(19)20/h3-9,16,24H,2H2,1H3,(H2,22,23,26)/b21-9- |
| InChIKey | PCTDYRDEWUSBBX-NKVSQWTQSA-N |
| XLogP | 5.08 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|