C22H22N4O2S — CID 135887673
(6R)-N,6-dimethyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 135887673) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is (6R)-N,6-dimethyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | (6R)-N,6-dimethyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 135887673 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (6R)-N,6-dimethyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | C[C@@H]1CCc2[nH]c3c(C(=O)N(C)Cc4nc5ccsc5c(=O)[nH]4)cccc3c2C1 |
| InChI | InChI=1S/C22H22N4O2S/c1-12-6-7-16-15(10-12)13-4-3-5-14(19(13)24-16)22(28)26(2)11-18-23-17-8-9-29-20(17)21(27)25-18/h3-5,8-9,12,24H,6-7,10-11H2,1-2H3,(H,23,25,27)/t12-/m1/s1 |
| InChIKey | PRQUDAFYPOFHHW-GFCCVEGCSA-N |
| XLogP | 3.86 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|