C21H17N5O3 — CID 135888709
(5S,6R)-2-(4-methoxyanilino)-4,7-dioxo-5-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 135888709) has the molecular formula C21H17N5O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is (5S,6R)-2-(4-methoxyanilino)-4,7-dioxo-5-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | (5S,6R)-2-(4-methoxyanilino)-4,7-dioxo-5-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 135888709 |
| Molecular Formula | C21H17N5O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (5S,6R)-2-(4-methoxyanilino)-4,7-dioxo-5-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | COc1ccc(Nc2nc3c(c(=O)[nH]2)[C@H](c2ccccc2)[C@H](C#N)C(=O)N3)cc1 |
| InChI | InChI=1S/C21H17N5O3/c1-29-14-9-7-13(8-10-14)23-21-25-18-17(20(28)26-21)16(12-5-3-2-4-6-12)15(11-22)19(27)24-18/h2-10,15-16H,1H3,(H3,23,24,25,26,27,28)/t15-,16+/m0/s1 |
| InChIKey | KGFZQAXZKULVJQ-JKSUJKDBSA-N |
| XLogP | 2.75 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |