About 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide
4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide (PubChem CID 135891201) has the molecular formula C17H20N4O3
and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide.
Molecular Properties
| Compound Name | 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide |
| PubChem CID | 135891201 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide |
| SMILES | Cc1nc(C)c(CC(=O)N(C)Cc2ccc(C(N)=O)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H20N4O3/c1-10-14(17(24)20-11(2)19-10)8-15(22)21(3)9-12-4-6-13(7-5-12)16(18)23/h4-7H,8-9H2,1-3H3,(H2,18,23)(H,19,20,24) |
| InChIKey | JCIZDYHJNMYEBC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide?
The IUPAC name of 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide (CID 135891201) is 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide.
What is the SMILES notation for 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide?
The canonical SMILES for 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide is Cc1nc(C)c(CC(=O)N(C)Cc2ccc(C(N)=O)cc2)c(=O)[nH]1.
What is the InChIKey of 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide?
The InChIKey is JCIZDYHJNMYEBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O3/c1-10-14(17(24)20-11(2)19-10)8-15(22)21(3)9-12-4-6-13(7-5-12)16(18)23/h4-7H,8-9H2,1-3H3,(H2,18,23)(H,19,20,24).
What are the key properties of 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide?
4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide has a molecular weight of 328.37 g/mol, XLogP of 0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetyl]-methylamino]methyl]benzamide is sourced from PubChem (CID 135891201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).