C23H25N5O2 — CID 135892225
2-cyclopentyl-N-[3-cyclopropyl-1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)pyrazol-5-yl]acetamide (PubChem CID 135892225) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-cyclopentyl-N-[3-cyclopropyl-1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)pyrazol-5-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-[3-cyclopropyl-1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 135892225 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-cyclopentyl-N-[3-cyclopropyl-1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)pyrazol-5-yl]acetamide |
| SMILES | O=C(CC1CCCC1)Nc1cc(C2CC2)nn1-c1nc(-c2ccccc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C23H25N5O2/c29-21(12-15-6-4-5-7-15)25-20-13-19(17-10-11-17)27-28(20)23-24-18(14-22(30)26-23)16-8-2-1-3-9-16/h1-3,8-9,13-15,17H,4-7,10-12H2,(H,25,29)(H,24,26,30) |
| InChIKey | ICOWTIKUGSJMFK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |