C23H21N5O3S — CID 135893028
2-[(3-methylphenyl)methylsulfanyl]-9-(2-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135893028) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methylsulfanyl]-9-(2-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-[(3-methylphenyl)methylsulfanyl]-9-(2-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135893028 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-[(3-methylphenyl)methylsulfanyl]-9-(2-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1cccc(CSc2nc3n(n2)C(c2ccccc2[N+](=O)[O-])C2=C(CCCC2=O)N3)c1 |
| InChI | InChI=1S/C23H21N5O3S/c1-14-6-4-7-15(12-14)13-32-23-25-22-24-17-9-5-11-19(29)20(17)21(27(22)26-23)16-8-2-3-10-18(16)28(30)31/h2-4,6-8,10,12,21H,5,9,11,13H2,1H3,(H,24,25,26) |
| InChIKey | OGLLIQUEHJGRJX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|