C25H26N4O2S — CID 136793378
(9R)-9-(2-ethoxyphenyl)-2-[(3-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136793378) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is (9R)-9-(2-ethoxyphenyl)-2-[(3-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(2-ethoxyphenyl)-2-[(3-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136793378 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (9R)-9-(2-ethoxyphenyl)-2-[(3-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCOc1ccccc1[C@@H]1C2=C(CCCC2=O)Nc2nc(SCc3cccc(C)c3)nn21 |
| InChI | InChI=1S/C25H26N4O2S/c1-3-31-21-13-5-4-10-18(21)23-22-19(11-7-12-20(22)30)26-24-27-25(28-29(23)24)32-15-17-9-6-8-16(2)14-17/h4-6,8-10,13-14,23H,3,7,11-12,15H2,1-2H3,(H,26,27,28)/t23-/m1/s1 |
| InChIKey | WSGBRJIXRZQUHN-HSZRJFAPSA-N |
| XLogP | 5.30 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |