C24H24N4O2S — CID 4025739
2-benzylsulfanyl-9-(4-ethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 4025739) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-benzylsulfanyl-9-(4-ethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-benzylsulfanyl-9-(4-ethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 4025739 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-benzylsulfanyl-9-(4-ethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCOc1ccc(C2C3=C(CCCC3=O)Nc3nc(SCc4ccccc4)nn32)cc1 |
| InChI | InChI=1S/C24H24N4O2S/c1-2-30-18-13-11-17(12-14-18)22-21-19(9-6-10-20(21)29)25-23-26-24(27-28(22)23)31-15-16-7-4-3-5-8-16/h3-5,7-8,11-14,22H,2,6,9-10,15H2,1H3,(H,25,26,27) |
| InChIKey | DZXNRDBBESQKPT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |