C21H19N5OS — CID 136690242
(9R)-2-benzylsulfanyl-9-pyridin-3-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136690242) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is (9R)-2-benzylsulfanyl-9-pyridin-3-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-2-benzylsulfanyl-9-pyridin-3-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136690242 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (9R)-2-benzylsulfanyl-9-pyridin-3-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCCC2=C1[C@@H](c1cccnc1)n1nc(SCc3ccccc3)nc1N2 |
| InChI | InChI=1S/C21H19N5OS/c27-17-10-4-9-16-18(17)19(15-8-5-11-22-12-15)26-20(23-16)24-21(25-26)28-13-14-6-2-1-3-7-14/h1-3,5-8,11-12,19H,4,9-10,13H2,(H,23,24,25)/t19-/m1/s1 |
| InChIKey | NRYYFPRTGMLJRM-LJQANCHMSA-N |
| XLogP | 3.99 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |