C19H16FN5O3 — CID 135894305
2-[(R)-amino-(3-fluorophenoxy)methyl]-8-methoxy-6-(1H-pyrazol-4-yl)-3H-quinazolin-4-one (PubChem CID 135894305) has the molecular formula C19H16FN5O3 and a molecular weight of 381.37 g/mol. Its IUPAC name is 2-[(R)-amino-(3-fluorophenoxy)methyl]-8-methoxy-6-(1H-pyrazol-4-yl)-3H-quinazolin-4-one.
| Compound Name | 2-[(R)-amino-(3-fluorophenoxy)methyl]-8-methoxy-6-(1H-pyrazol-4-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135894305 |
| Molecular Formula | C19H16FN5O3 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[(R)-amino-(3-fluorophenoxy)methyl]-8-methoxy-6-(1H-pyrazol-4-yl)-3H-quinazolin-4-one |
| SMILES | COc1cc(-c2cn[nH]c2)cc2c(=O)[nH]c([C@H](N)Oc3cccc(F)c3)nc12 |
| InChI | InChI=1S/C19H16FN5O3/c1-27-15-6-10(11-8-22-23-9-11)5-14-16(15)24-18(25-19(14)26)17(21)28-13-4-2-3-12(20)7-13/h2-9,17H,21H2,1H3,(H,22,23)(H,24,25,26)/t17-/m1/s1 |
| InChIKey | CAKOTKXICIXZAY-QGZVFWFLSA-N |
| XLogP | 2.50 |
| TPSA | 118.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|