C25H21FN4O2 — CID 158321070
1-[6-(3-fluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one (PubChem CID 158321070) has the molecular formula C25H21FN4O2 and a molecular weight of 428.47 g/mol. Its IUPAC name is 1-[6-(3-fluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one.
| Compound Name | 1-[6-(3-fluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one |
|---|---|
| PubChem CID | 158321070 |
| Molecular Formula | C25H21FN4O2 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1-[6-(3-fluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one |
| SMILES | COc1cc(-c2cccc(F)c2)cc2c(N3CCCC(=O)C3)nc(-c3cccnc3)nc12 |
| InChI | InChI=1S/C25H21FN4O2/c1-32-22-13-18(16-5-2-7-19(26)11-16)12-21-23(22)28-24(17-6-3-9-27-14-17)29-25(21)30-10-4-8-20(31)15-30/h2-3,5-7,9,11-14H,4,8,10,15H2,1H3 |
| InChIKey | GOVXVVBNUUEIDT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |