C16H16N4OS — CID 135894942
2-[(4-phenyl-1,3-thiazol-2-yl)amino]-4-propyl-1H-pyrimidin-6-one (PubChem CID 135894942) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 2-[(4-phenyl-1,3-thiazol-2-yl)amino]-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(4-phenyl-1,3-thiazol-2-yl)amino]-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135894942 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-[(4-phenyl-1,3-thiazol-2-yl)amino]-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(Nc2nc(-c3ccccc3)cs2)n1 |
| InChI | InChI=1S/C16H16N4OS/c1-2-6-12-9-14(21)19-15(17-12)20-16-18-13(10-22-16)11-7-4-3-5-8-11/h3-5,7-10H,2,6H2,1H3,(H2,17,18,19,20,21) |
| InChIKey | PHWQCUZXLDCICO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |