C14H16N4O2S — CID 135895322
2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]sulfanyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 135895322) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]sulfanyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]sulfanyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135895322 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[[5-amino-6-(cyclopropylmethoxy)-2-pyridinyl]sulfanyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(Sc2ccc(N)c(OCC3CC3)n2)n1 |
| InChI | InChI=1S/C14H16N4O2S/c1-8-6-11(19)17-14(16-8)21-12-5-4-10(15)13(18-12)20-7-9-2-3-9/h4-6,9H,2-3,7,15H2,1H3,(H,16,17,19) |
| InChIKey | XOMZMDSNISUWTJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |