C21H21N3O3 — CID 135896413
6-hydroxy-1-(2-methylphenyl)-5-[C-methyl-N-[(1S)-1-phenylethyl]carbonimidoyl]pyrimidine-2,4-dione (PubChem CID 135896413) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 6-hydroxy-1-(2-methylphenyl)-5-[C-methyl-N-[(1S)-1-phenylethyl]carbonimidoyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-(2-methylphenyl)-5-[C-methyl-N-[(1S)-1-phenylethyl]carbonimidoyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135896413 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-hydroxy-1-(2-methylphenyl)-5-[C-methyl-N-[(1S)-1-phenylethyl]carbonimidoyl]pyrimidine-2,4-dione |
| SMILES | C/C(=N\[C@@H](C)c1ccccc1)c1c(O)n(-c2ccccc2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H21N3O3/c1-13-9-7-8-12-17(13)24-20(26)18(19(25)23-21(24)27)15(3)22-14(2)16-10-5-4-6-11-16/h4-12,14,26H,1-3H3,(H,23,25,27)/b22-15+/t14-/m0/s1 |
| InChIKey | AXBDCVGDJLKBRI-UGHXVNEISA-N |
| XLogP | 3.11 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|