C22H21N3O3 — CID 135896471
ethyl (5S,6S)-2-methyl-7-oxo-3,5-diphenyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135896471) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is ethyl (5S,6S)-2-methyl-7-oxo-3,5-diphenyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5S,6S)-2-methyl-7-oxo-3,5-diphenyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135896471 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | ethyl (5S,6S)-2-methyl-7-oxo-3,5-diphenyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)n2nc(C)c(-c3ccccc3)c2N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H21N3O3/c1-3-28-22(27)18-19(16-12-8-5-9-13-16)23-20-17(15-10-6-4-7-11-15)14(2)24-25(20)21(18)26/h4-13,18-19,23H,3H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | QAGWEFWKHKRCBD-RBUKOAKNSA-N |
| XLogP | 3.84 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|