C10H15N3O2 — CID 135896882
2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-ethylacetamide (PubChem CID 135896882) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-ethylacetamide.
| Compound Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 135896882 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-ethylacetamide |
| SMILES | CCNC(=O)Cc1c(C)nc(C)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O2/c1-4-11-9(14)5-8-6(2)12-7(3)13-10(8)15/h4-5H2,1-3H3,(H,11,14)(H,12,13,15) |
| InChIKey | UIGVMRNBLNTPPF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |