C21H24N4O2 — CID 135899343
4-(aminomethyl)-2-[4-[[methyl(2-phenoxyethyl)amino]methyl]phenyl]-1H-pyrimidin-6-one (PubChem CID 135899343) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-(aminomethyl)-2-[4-[[methyl(2-phenoxyethyl)amino]methyl]phenyl]-1H-pyrimidin-6-one.
| Compound Name | 4-(aminomethyl)-2-[4-[[methyl(2-phenoxyethyl)amino]methyl]phenyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135899343 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-(aminomethyl)-2-[4-[[methyl(2-phenoxyethyl)amino]methyl]phenyl]-1H-pyrimidin-6-one |
| SMILES | CN(CCOc1ccccc1)Cc1ccc(-c2nc(CN)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-25(11-12-27-19-5-3-2-4-6-19)15-16-7-9-17(10-8-16)21-23-18(14-22)13-20(26)24-21/h2-10,13H,11-12,14-15,22H2,1H3,(H,23,24,26) |
| InChIKey | NBWBWTAEOSMYOW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |