C22H19ClN2O3S — CID 135901393
2-[(5R,10bR)-7-ethoxy-5-thiophen-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-chlorophenol (PubChem CID 135901393) has the molecular formula C22H19ClN2O3S and a molecular weight of 426.93 g/mol. Its IUPAC name is 2-[(5R,10bR)-7-ethoxy-5-thiophen-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-chlorophenol.
| Compound Name | 2-[(5R,10bR)-7-ethoxy-5-thiophen-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 135901393 |
| Molecular Formula | C22H19ClN2O3S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2-[(5R,10bR)-7-ethoxy-5-thiophen-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-chlorophenol |
| SMILES | CCOc1cccc2c1O[C@H](c1ccsc1)N1N=C(c3cc(Cl)ccc3O)C[C@H]21 |
| InChI | InChI=1S/C22H19ClN2O3S/c1-2-27-20-5-3-4-15-18-11-17(16-10-14(23)6-7-19(16)26)24-25(18)22(28-21(15)20)13-8-9-29-12-13/h3-10,12,18,22,26H,2,11H2,1H3/t18-,22-/m1/s1 |
| InChIKey | LPDDLBIBEDCDEM-XMSQKQJNSA-N |
| XLogP | 5.75 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|