C21H17ClN2O3S — CID 135760526
4-chloro-2-(7-methoxy-5-thiophen-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl)phenol (PubChem CID 135760526) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is 4-chloro-2-(7-methoxy-5-thiophen-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl)phenol.
| Compound Name | 4-chloro-2-(7-methoxy-5-thiophen-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl)phenol |
|---|---|
| PubChem CID | 135760526 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-chloro-2-(7-methoxy-5-thiophen-3-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl)phenol |
| SMILES | COc1cccc2c1OC(c1ccsc1)N1N=C(c3cc(Cl)ccc3O)CC21 |
| InChI | InChI=1S/C21H17ClN2O3S/c1-26-19-4-2-3-14-17-10-16(15-9-13(22)5-6-18(15)25)23-24(17)21(27-20(14)19)12-7-8-28-11-12/h2-9,11,17,21,25H,10H2,1H3 |
| InChIKey | NISITWDMQGXPRL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|