C20H21ClN2O3 — CID 136753489
2-[(5S,10bS)-7-methoxy-5-propan-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-chlorophenol (PubChem CID 136753489) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 2-[(5S,10bS)-7-methoxy-5-propan-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-chlorophenol.
| Compound Name | 2-[(5S,10bS)-7-methoxy-5-propan-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 136753489 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[(5S,10bS)-7-methoxy-5-propan-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-chlorophenol |
| SMILES | COc1cccc2c1O[C@@H](C(C)C)N1N=C(c3cc(Cl)ccc3O)C[C@@H]21 |
| InChI | InChI=1S/C20H21ClN2O3/c1-11(2)20-23-16(13-5-4-6-18(25-3)19(13)26-20)10-15(22-23)14-9-12(21)7-8-17(14)24/h4-9,11,16,20,24H,10H2,1-3H3/t16-,20-/m0/s1 |
| InChIKey | IZITVIKIAXTQAK-JXFKEZNVSA-N |
| XLogP | 4.58 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|