C19H14F2N4O4S — CID 135901490
N-(3,4-difluorophenyl)-2-[[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetamide (PubChem CID 135901490) has the molecular formula C19H14F2N4O4S and a molecular weight of 432.41 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135901490 |
| Molecular Formula | C19H14F2N4O4S |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[[6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc3c(c2)OCCO3)c(=O)[nH]1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H14F2N4O4S/c20-12-3-2-11(8-13(12)21)22-16(26)9-30-19-23-18(27)17(24-25-19)10-1-4-14-15(7-10)29-6-5-28-14/h1-4,7-8H,5-6,9H2,(H,22,26)(H,23,25,27) |
| InChIKey | HPVQICNUBMGMAO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |