C17H17N5O3 — CID 135904475
(6S,9R)-2,6-dimethyl-9-(2-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135904475) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is (6S,9R)-2,6-dimethyl-9-(2-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6S,9R)-2,6-dimethyl-9-(2-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135904475 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (6S,9R)-2,6-dimethyl-9-(2-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1nc2n(n1)[C@H](c1ccccc1[N+](=O)[O-])C1=C(C[C@H](C)CC1=O)N2 |
| InChI | InChI=1S/C17H17N5O3/c1-9-7-12-15(14(23)8-9)16(21-17(19-12)18-10(2)20-21)11-5-3-4-6-13(11)22(24)25/h3-6,9,16H,7-8H2,1-2H3,(H,18,19,20)/t9-,16+/m0/s1 |
| InChIKey | PTXSXZYJBXUNTQ-XXFAHNHDSA-N |
| XLogP | 2.76 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|