C18H20N4O — CID 135904564
(6R,9R)-2,6-dimethyl-9-(2-methylphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135904564) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is (6R,9R)-2,6-dimethyl-9-(2-methylphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R,9R)-2,6-dimethyl-9-(2-methylphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135904564 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (6R,9R)-2,6-dimethyl-9-(2-methylphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1nc2n(n1)[C@H](c1ccccc1C)C1=C(C[C@@H](C)CC1=O)N2 |
| InChI | InChI=1S/C18H20N4O/c1-10-8-14-16(15(23)9-10)17(13-7-5-4-6-11(13)2)22-18(20-14)19-12(3)21-22/h4-7,10,17H,8-9H2,1-3H3,(H,19,20,21)/t10-,17-/m1/s1 |
| InChIKey | KRJDRJORGHUGGW-BMLIUANNSA-N |
| XLogP | 3.16 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |