C15H13F2N3OS — CID 135907782
2-[(2,3-difluorophenyl)methylsulfanyl]-6-oxo-4-propan-2-yl-1H-pyrimidine-5-carbonitrile (PubChem CID 135907782) has the molecular formula C15H13F2N3OS and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methylsulfanyl]-6-oxo-4-propan-2-yl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-6-oxo-4-propan-2-yl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135907782 |
| Molecular Formula | C15H13F2N3OS |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-6-oxo-4-propan-2-yl-1H-pyrimidine-5-carbonitrile |
| SMILES | CC(C)c1nc(SCc2cccc(F)c2F)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C15H13F2N3OS/c1-8(2)13-10(6-18)14(21)20-15(19-13)22-7-9-4-3-5-11(16)12(9)17/h3-5,8H,7H2,1-2H3,(H,19,20,21) |
| InChIKey | XXPYFOCNASVVFD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|