C20H16F3N5OS — CID 135914255
(6R,9S)-2-amino-6-thiophen-2-yl-9-[4-(trifluoromethyl)phenyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135914255) has the molecular formula C20H16F3N5OS and a molecular weight of 431.44 g/mol. Its IUPAC name is (6R,9S)-2-amino-6-thiophen-2-yl-9-[4-(trifluoromethyl)phenyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R,9S)-2-amino-6-thiophen-2-yl-9-[4-(trifluoromethyl)phenyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135914255 |
| Molecular Formula | C20H16F3N5OS |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (6R,9S)-2-amino-6-thiophen-2-yl-9-[4-(trifluoromethyl)phenyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Nc1nc2n(n1)[C@@H](c1ccc(C(F)(F)F)cc1)C1=C(C[C@@H](c3cccs3)CC1=O)N2 |
| InChI | InChI=1S/C20H16F3N5OS/c21-20(22,23)12-5-3-10(4-6-12)17-16-13(25-19-26-18(24)27-28(17)19)8-11(9-14(16)29)15-2-1-7-30-15/h1-7,11,17H,8-9H2,(H3,24,25,26,27)/t11-,17+/m1/s1 |
| InChIKey | JSMQERGMOKIAOP-DIFFPNOSSA-N |
| XLogP | 4.36 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |