C19H16ClN5OS — CID 135646417
2-amino-9-(3-chlorophenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135646417) has the molecular formula C19H16ClN5OS and a molecular weight of 397.89 g/mol. Its IUPAC name is 2-amino-9-(3-chlorophenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-amino-9-(3-chlorophenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135646417 |
| Molecular Formula | C19H16ClN5OS |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-amino-9-(3-chlorophenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Nc1nc2n(n1)C(c1cccc(Cl)c1)C1=C(CC(c3cccs3)CC1=O)N2 |
| InChI | InChI=1S/C19H16ClN5OS/c20-12-4-1-3-10(7-12)17-16-13(22-19-23-18(21)24-25(17)19)8-11(9-14(16)26)15-5-2-6-27-15/h1-7,11,17H,8-9H2,(H3,21,22,23,24) |
| InChIKey | BTHWJZMYYVXPRQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |