C20H16ClN3O2S — CID 71950244
4-(3-chlorophenyl)-7-thiophen-2-yl-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 71950244) has the molecular formula C20H16ClN3O2S and a molecular weight of 397.89 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-7-thiophen-2-yl-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | 4-(3-chlorophenyl)-7-thiophen-2-yl-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 71950244 |
| Molecular Formula | C20H16ClN3O2S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-(3-chlorophenyl)-7-thiophen-2-yl-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | O=C1CC(c2cccs2)CC2=C1C(c1cccc(Cl)c1)c1c([nH][nH]c1=O)N2 |
| InChI | InChI=1S/C20H16ClN3O2S/c21-12-4-1-3-10(7-12)16-17-13(22-19-18(16)20(26)24-23-19)8-11(9-14(17)25)15-5-2-6-27-15/h1-7,11,16H,8-9H2,(H3,22,23,24,26) |
| InChIKey | DMPSCDKQTSWQQU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |