C26H20ClN3O2S — CID 71950262
4-(4-chlorophenyl)-2-phenyl-7-thiophen-2-yl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 71950262) has the molecular formula C26H20ClN3O2S and a molecular weight of 473.99 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-phenyl-7-thiophen-2-yl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | 4-(4-chlorophenyl)-2-phenyl-7-thiophen-2-yl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 71950262 |
| Molecular Formula | C26H20ClN3O2S |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 4-(4-chlorophenyl)-2-phenyl-7-thiophen-2-yl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | O=C1CC(c2cccs2)CC2=C1C(c1ccc(Cl)cc1)c1c([nH]n(-c3ccccc3)c1=O)N2 |
| InChI | InChI=1S/C26H20ClN3O2S/c27-17-10-8-15(9-11-17)22-23-19(13-16(14-20(23)31)21-7-4-12-33-21)28-25-24(22)26(32)30(29-25)18-5-2-1-3-6-18/h1-12,16,22,28-29H,13-14H2 |
| InChIKey | WQBPDFPLEBVZCE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |