C24H18BrN3O2S2 — CID 98168580
(4R,7S)-4-(5-bromothiophen-2-yl)-2-phenyl-7-thiophen-2-yl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 98168580) has the molecular formula C24H18BrN3O2S2 and a molecular weight of 524.47 g/mol. Its IUPAC name is (4R,7S)-4-(5-bromothiophen-2-yl)-2-phenyl-7-thiophen-2-yl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | (4R,7S)-4-(5-bromothiophen-2-yl)-2-phenyl-7-thiophen-2-yl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 98168580 |
| Molecular Formula | C24H18BrN3O2S2 |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 523.00 |
| IUPAC Name | (4R,7S)-4-(5-bromothiophen-2-yl)-2-phenyl-7-thiophen-2-yl-1,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | O=C1C[C@@H](c2cccs2)CC2=C1[C@@H](c1ccc(Br)s1)c1c([nH]n(-c3ccccc3)c1=O)N2 |
| InChI | InChI=1S/C24H18BrN3O2S2/c25-19-9-8-18(32-19)21-20-15(11-13(12-16(20)29)17-7-4-10-31-17)26-23-22(21)24(30)28(27-23)14-5-2-1-3-6-14/h1-10,13,21,26-27H,11-12H2/t13-,21+/m0/s1 |
| InChIKey | IBNBTFDDFCJJTB-YEJXKQKISA-N |
| XLogP | 6.01 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |