C14H22N6O4 — CID 135914681
(6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5-[(2S)-pyrrolidine-2-carbonyl]-3,6,7,8-tetrahydropteridin-4-one (PubChem CID 135914681) has the molecular formula C14H22N6O4 and a molecular weight of 338.37 g/mol. Its IUPAC name is (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5-[(2S)-pyrrolidine-2-carbonyl]-3,6,7,8-tetrahydropteridin-4-one.
| Compound Name | (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5-[(2S)-pyrrolidine-2-carbonyl]-3,6,7,8-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 135914681 |
| Molecular Formula | C14H22N6O4 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5-[(2S)-pyrrolidine-2-carbonyl]-3,6,7,8-tetrahydropteridin-4-one |
| SMILES | C[C@H](O)[C@H](O)[C@H]1CNc2nc(N)[nH]c(=O)c2N1C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C14H22N6O4/c1-6(21)10(22)8-5-17-11-9(12(23)19-14(15)18-11)20(8)13(24)7-3-2-4-16-7/h6-8,10,16,21-22H,2-5H2,1H3,(H4,15,17,18,19,23)/t6-,7-,8+,10-/m0/s1 |
| InChIKey | ZHXNZMIPSMFHHC-OORONAJNSA-N |
| XLogP | -2.03 |
| TPSA | 156.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |