C15H14F3N3O4 — CID 135916530
2-(trifluoromethyl)-6-[(2,3,4-trihydroxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135916530) has the molecular formula C15H14F3N3O4 and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-(trifluoromethyl)-6-[(2,3,4-trihydroxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(trifluoromethyl)-6-[(2,3,4-trihydroxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135916530 |
| Molecular Formula | C15H14F3N3O4 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-(trifluoromethyl)-6-[(2,3,4-trihydroxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2c1CN(Cc1ccc(O)c(O)c1O)CC2 |
| InChI | InChI=1S/C15H14F3N3O4/c16-15(17,18)14-19-9-3-4-21(6-8(9)13(25)20-14)5-7-1-2-10(22)12(24)11(7)23/h1-2,22-24H,3-6H2,(H,19,20,25) |
| InChIKey | DFJSWUCTLWGMRO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|