C22H19F3N4O4 — CID 135918122
6-[(2-methoxy-5-nitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135918122) has the molecular formula C22H19F3N4O4 and a molecular weight of 460.41 g/mol. Its IUPAC name is 6-[(2-methoxy-5-nitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2-methoxy-5-nitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135918122 |
| Molecular Formula | C22H19F3N4O4 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 6-[(2-methoxy-5-nitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CCc2nc(-c3ccc(C(F)(F)F)cc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C22H19F3N4O4/c1-33-19-7-6-16(29(31)32)10-14(19)11-28-9-8-18-17(12-28)21(30)27-20(26-18)13-2-4-15(5-3-13)22(23,24)25/h2-7,10H,8-9,11-12H2,1H3,(H,26,27,30) |
| InChIKey | YDVNKUPZUSHSKV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|