C20H24N4O3 — CID 135918182
2-cyclohexyl-6-[(2-nitrophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135918182) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-cyclohexyl-6-[(2-nitrophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-cyclohexyl-6-[(2-nitrophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135918182 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-cyclohexyl-6-[(2-nitrophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2CCCCC2)nc2c1CN(Cc1ccccc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C20H24N4O3/c25-20-16-13-23(12-15-8-4-5-9-18(15)24(26)27)11-10-17(16)21-19(22-20)14-6-2-1-3-7-14/h4-5,8-9,14H,1-3,6-7,10-13H2,(H,21,22,25) |
| InChIKey | QCEPHQLVFACFIH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|