C24H25ClN4O4 — CID 135943915
6-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-cyclohexyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135943915) has the molecular formula C24H25ClN4O4 and a molecular weight of 468.94 g/mol. Its IUPAC name is 6-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-cyclohexyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-cyclohexyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135943915 |
| Molecular Formula | C24H25ClN4O4 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 6-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-cyclohexyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2CCCCC2)nc2c1CN(Cc1ccc(-c3ccc(Cl)cc3[N+](=O)[O-])o1)CC2 |
| InChI | InChI=1S/C24H25ClN4O4/c25-16-6-8-18(21(12-16)29(31)32)22-9-7-17(33-22)13-28-11-10-20-19(14-28)24(30)27-23(26-20)15-4-2-1-3-5-15/h6-9,12,15H,1-5,10-11,13-14H2,(H,26,27,30) |
| InChIKey | LVILXYIQSMRQLI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|