C19H17ClN4O3S — CID 24912392
6-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24912392) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is 6-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24912392 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 6-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methyl]-2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | CSc1ncc2c(n1)CCN(Cc1ccc(-c3ccc(Cl)cc3[N+](=O)[O-])o1)C2 |
| InChI | InChI=1S/C19H17ClN4O3S/c1-28-19-21-9-12-10-23(7-6-16(12)22-19)11-14-3-5-18(27-14)15-4-2-13(20)8-17(15)24(25)26/h2-5,8-9H,6-7,10-11H2,1H3 |
| InChIKey | YNYIOYYCUCHIKB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|