About [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate
[5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate (PubChem CID 24908615) has the molecular formula C16H19N3O3S
and a molecular weight of 333.41 g/mol. Its IUPAC name is [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate |
| PubChem CID | 24908615 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate |
| SMILES | CSc1ncc2c(n1)CCN(Cc1ccc(COC(C)=O)o1)C2 |
| InChI | InChI=1S/C16H19N3O3S/c1-11(20)21-10-14-4-3-13(22-14)9-19-6-5-15-12(8-19)7-17-16(18-15)23-2/h3-4,7H,5-6,8-10H2,1-2H3 |
| InChIKey | SPKIUAVHKLVMFP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate?
The IUPAC name of [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate (CID 24908615) is [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate.
What is the SMILES notation for [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate?
The canonical SMILES for [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate is CSc1ncc2c(n1)CCN(Cc1ccc(COC(C)=O)o1)C2.
What is the InChIKey of [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate?
The InChIKey is SPKIUAVHKLVMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3S/c1-11(20)21-10-14-4-3-13(22-14)9-19-6-5-15-12(8-19)7-17-16(18-15)23-2/h3-4,7H,5-6,8-10H2,1-2H3.
What are the key properties of [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate?
[5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate has a molecular weight of 333.41 g/mol, XLogP of 2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2-methylsulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-yl]methyl acetate is sourced from PubChem (CID 24908615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).