C20H18ClFN4O — CID 135918618
2-(4-aminophenyl)-6-[(3-chloro-2-fluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135918618) has the molecular formula C20H18ClFN4O and a molecular weight of 384.84 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[(3-chloro-2-fluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[(3-chloro-2-fluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135918618 |
| Molecular Formula | C20H18ClFN4O |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-(4-aminophenyl)-6-[(3-chloro-2-fluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Nc1ccc(-c2nc3c(c(=O)[nH]2)CN(Cc2cccc(Cl)c2F)CC3)cc1 |
| InChI | InChI=1S/C20H18ClFN4O/c21-16-3-1-2-13(18(16)22)10-26-9-8-17-15(11-26)20(27)25-19(24-17)12-4-6-14(23)7-5-12/h1-7H,8-11,23H2,(H,24,25,27) |
| InChIKey | TVOFGNHGEUVKTJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|