C19H18BrN5O — CID 135946113
2-(4-aminophenyl)-6-[(2-bromo-3-pyridinyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135946113) has the molecular formula C19H18BrN5O and a molecular weight of 412.29 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[(2-bromo-3-pyridinyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[(2-bromo-3-pyridinyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135946113 |
| Molecular Formula | C19H18BrN5O |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2-(4-aminophenyl)-6-[(2-bromo-3-pyridinyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Nc1ccc(-c2nc3c(c(=O)[nH]2)CN(Cc2cccnc2Br)CC3)cc1 |
| InChI | InChI=1S/C19H18BrN5O/c20-17-13(2-1-8-22-17)10-25-9-7-16-15(11-25)19(26)24-18(23-16)12-3-5-14(21)6-4-12/h1-6,8H,7,9-11,21H2,(H,23,24,26) |
| InChIKey | ORSKOEGVVFWWEW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|